4-(1-PYRROLIDINYL)PIPERIDINE 2HCL
4-(1-Pyrrolidinyl)piperidine
CAS: 5004-07-9
Molecular Formula: C9H18N2
4-(1-PYRROLIDINYL)PIPERIDINE 2HCL - Names and Identifiers
| Name | 4-(1-Pyrrolidinyl)piperidine |
| Synonyms | AKOS BB-9181 4-PYRROLIDINOPIPERIDINE 4-Pyrrolidinopiperidine 4-(1H-pyrrol-1-yl)pyridine 4-PYRROLIDIN-1-YL-PIPERIDINE 4-(1-PYRROLIDINYL)PIPERIDINE 4-(1-Pyrrolidinyl)piperidine 4-(pyrrolidin-1-yl)piperidine 4-(1-PYRROLIDINYL)PIPERIDINE 2HCL |
| CAS | 5004-07-9 |
| EINECS | 225-676-6 |
| InChI | InChI=1/C9H8N2/c1-2-8-11(7-1)9-3-5-10-6-4-9/h1-8H |
4-(1-PYRROLIDINYL)PIPERIDINE 2HCL - Physico-chemical Properties
| Molecular Formula | C9H18N2 |
| Molar Mass | 154.25 |
| Density | 0.989±0.06 g/cm3(Predicted) |
| Melting Point | 53-56°C(lit.) |
| Boling Point | 228.8±8.0 °C(Predicted) |
| Flash Point | 117.7°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.011mmHg at 25°C |
| Appearance | Crystals |
| Color | White |
| pKa | 10.32±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.591 |
| MDL | MFCD00038011 |
4-(1-PYRROLIDINYL)PIPERIDINE 2HCL - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Note | Irritant |
| Hazard Class | 8 |
4-(1-PYRROLIDINYL)PIPERIDINE 2HCL - Introduction
4-(1-Pyrrolidinyl)piperidine is an organic compound with the chemical formula C11H20N2. It has the following properties:
1. Appearance: 4-(1-Pyrrolidinyl)piperidine is a colorless to light yellow liquid or crystalline solid.
2. Solubility: It has low solubility in water, but is soluble in organic solvents such as ethanol, ether and dimethylformamide.
3. chemical properties: 4-(1-Pyrrolidinyl)piperidine belongs to piperidine compounds, with basic. It can react with acids to form salt compounds. It can be used as a catalyst in some organic synthesis reactions.
Some uses of the
4-(1-Pyrrolidinyl)piperidine include:
1. Catalyst: It can be used in the preparation of synthetic organic compounds and polymers, such as polyurethane.
2. Drug intermediates: It can be used to synthesize drugs, such as analgesic drugs, antidepressants, etc.
The method for preparing 4-(1-Pyrrolidinyl)piperidine mainly includes:
1. reaction of piperidine and pyrrolidine: under appropriate conditions, piperidine and pyrrolidine can be heated to react in an organic solvent to obtain 4-(1-Pyrrolidinyl)piperidine.
Safety Information:
1. 4-(1-Pyrrolidinyl)piperidine is a chemical that should follow general laboratory safety practices.
2. it may be irritating to the eyes, skin and respiratory tract, should wear appropriate protective equipment.
3. It should be stored in a dry, well-ventilated place, away from heat and fire sources.
4. Use should be careful to avoid contact with sparks, open flames and high temperatures to prevent combustion or explosion. In case of fire, appropriate fire extinguishing measures shall be taken.
1. Appearance: 4-(1-Pyrrolidinyl)piperidine is a colorless to light yellow liquid or crystalline solid.
2. Solubility: It has low solubility in water, but is soluble in organic solvents such as ethanol, ether and dimethylformamide.
3. chemical properties: 4-(1-Pyrrolidinyl)piperidine belongs to piperidine compounds, with basic. It can react with acids to form salt compounds. It can be used as a catalyst in some organic synthesis reactions.
Some uses of the
4-(1-Pyrrolidinyl)piperidine include:
1. Catalyst: It can be used in the preparation of synthetic organic compounds and polymers, such as polyurethane.
2. Drug intermediates: It can be used to synthesize drugs, such as analgesic drugs, antidepressants, etc.
The method for preparing 4-(1-Pyrrolidinyl)piperidine mainly includes:
1. reaction of piperidine and pyrrolidine: under appropriate conditions, piperidine and pyrrolidine can be heated to react in an organic solvent to obtain 4-(1-Pyrrolidinyl)piperidine.
Safety Information:
1. 4-(1-Pyrrolidinyl)piperidine is a chemical that should follow general laboratory safety practices.
2. it may be irritating to the eyes, skin and respiratory tract, should wear appropriate protective equipment.
3. It should be stored in a dry, well-ventilated place, away from heat and fire sources.
4. Use should be careful to avoid contact with sparks, open flames and high temperatures to prevent combustion or explosion. In case of fire, appropriate fire extinguishing measures shall be taken.
Last Update：2024-04-09 18:58:34
Supplier List
Spot supply
Product Name: 4-(1-Pyrrolidinyl)Piperidine Visit Supplier Webpage Request for quotationCAS: 5004-07-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 4-(1-Pyrrolidinyl)Piperidine Visit Supplier Webpage Request for quotationCAS: 5004-07-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History